C18H23N3O6 — CID 4672915
N-hydroxy-2-[6-propoxy-2-(3,4,5-trimethoxyphenyl)pyrimidin-4-yl]acetamide (PubChem CID 4672915) has the molecular formula C18H23N3O6 and a molecular weight of 377.40 g/mol. Its IUPAC name is N-hydroxy-2-[6-propoxy-2-(3,4,5-trimethoxyphenyl)pyrimidin-4-yl]acetamide.
| Compound Name | N-hydroxy-2-[6-propoxy-2-(3,4,5-trimethoxyphenyl)pyrimidin-4-yl]acetamide |
|---|---|
| PubChem CID | 4672915 |
| Molecular Formula | C18H23N3O6 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | N-hydroxy-2-[6-propoxy-2-(3,4,5-trimethoxyphenyl)pyrimidin-4-yl]acetamide |
| SMILES | CCCOc1cc(CC(=O)NO)nc(-c2cc(OC)c(OC)c(OC)c2)n1 |
| InChI | InChI=1S/C18H23N3O6/c1-5-6-27-16-10-12(9-15(22)21-23)19-18(20-16)11-7-13(24-2)17(26-4)14(8-11)25-3/h7-8,10,23H,5-6,9H2,1-4H3,(H,21,22) |
| InChIKey | XVXSDHNFOSJAJC-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 112.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|