C15H21NO6 — CID 2572054
[2-oxo-2-(propylamino)ethyl] 3,4,5-trimethoxybenzoate (PubChem CID 2572054) has the molecular formula C15H21NO6 and a molecular weight of 311.33 g/mol. Its IUPAC name is [2-oxo-2-(propylamino)ethyl] 3,4,5-trimethoxybenzoate.
| Compound Name | [2-oxo-2-(propylamino)ethyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 2572054 |
| Molecular Formula | C15H21NO6 |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | [2-oxo-2-(propylamino)ethyl] 3,4,5-trimethoxybenzoate |
| SMILES | CCCNC(=O)COC(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C15H21NO6/c1-5-6-16-13(17)9-22-15(18)10-7-11(19-2)14(21-4)12(8-10)20-3/h7-8H,5-6,9H2,1-4H3,(H,16,17) |
| InChIKey | LMAHTDBJVXYJHZ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |