C16H21ClN2O6 — CID 8952490
[2-(butylcarbamoylamino)-2-oxoethyl] 3-chloro-4,5-dimethoxybenzoate (PubChem CID 8952490) has the molecular formula C16H21ClN2O6 and a molecular weight of 372.81 g/mol. Its IUPAC name is [2-(butylcarbamoylamino)-2-oxoethyl] 3-chloro-4,5-dimethoxybenzoate.
| Compound Name | [2-(butylcarbamoylamino)-2-oxoethyl] 3-chloro-4,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 8952490 |
| Molecular Formula | C16H21ClN2O6 |
| Molecular Weight | 372.81 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | [2-(butylcarbamoylamino)-2-oxoethyl] 3-chloro-4,5-dimethoxybenzoate |
| SMILES | CCCCNC(=O)NC(=O)COC(=O)c1cc(Cl)c(OC)c(OC)c1 |
| InChI | InChI=1S/C16H21ClN2O6/c1-4-5-6-18-16(22)19-13(20)9-25-15(21)10-7-11(17)14(24-3)12(8-10)23-2/h7-8H,4-6,9H2,1-3H3,(H2,18,19,20,22) |
| InChIKey | JDVISYYRVKPNSU-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.81 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|