C17H23ClN2O6 — CID 7684481
[2-(methylcarbamoylamino)-2-oxoethyl] 4-butoxy-3-chloro-5-ethoxybenzoate (PubChem CID 7684481) has the molecular formula C17H23ClN2O6 and a molecular weight of 386.83 g/mol. Its IUPAC name is [2-(methylcarbamoylamino)-2-oxoethyl] 4-butoxy-3-chloro-5-ethoxybenzoate.
| Compound Name | [2-(methylcarbamoylamino)-2-oxoethyl] 4-butoxy-3-chloro-5-ethoxybenzoate |
|---|---|
| PubChem CID | 7684481 |
| Molecular Formula | C17H23ClN2O6 |
| Molecular Weight | 386.83 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | [2-(methylcarbamoylamino)-2-oxoethyl] 4-butoxy-3-chloro-5-ethoxybenzoate |
| SMILES | CCCCOc1c(Cl)cc(C(=O)OCC(=O)NC(=O)NC)cc1OCC |
| InChI | InChI=1S/C17H23ClN2O6/c1-4-6-7-25-15-12(18)8-11(9-13(15)24-5-2)16(22)26-10-14(21)20-17(23)19-3/h8-9H,4-7,10H2,1-3H3,(H2,19,20,21,23) |
| InChIKey | GFOLPLWAAPIJIQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.83 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|