C18H26ClNO5 — CID 8603349
[(2R)-1-(ethylamino)-1-oxopropan-2-yl] 4-butoxy-3-chloro-5-ethoxybenzoate (PubChem CID 8603349) has the molecular formula C18H26ClNO5 and a molecular weight of 371.86 g/mol. Its IUPAC name is [(2R)-1-(ethylamino)-1-oxopropan-2-yl] 4-butoxy-3-chloro-5-ethoxybenzoate.
| Compound Name | [(2R)-1-(ethylamino)-1-oxopropan-2-yl] 4-butoxy-3-chloro-5-ethoxybenzoate |
|---|---|
| PubChem CID | 8603349 |
| Molecular Formula | C18H26ClNO5 |
| Molecular Weight | 371.86 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | [(2R)-1-(ethylamino)-1-oxopropan-2-yl] 4-butoxy-3-chloro-5-ethoxybenzoate |
| SMILES | CCCCOc1c(Cl)cc(C(=O)O[C@H](C)C(=O)NCC)cc1OCC |
| InChI | InChI=1S/C18H26ClNO5/c1-5-8-9-24-16-14(19)10-13(11-15(16)23-7-3)18(22)25-12(4)17(21)20-6-2/h10-12H,5-9H2,1-4H3,(H,20,21)/t12-/m1/s1 |
| InChIKey | WJAQTVQPEJCTHP-GFCCVEGCSA-N |
| XLogP | 3.60 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.86 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|