C18H24ClNO5 — CID 8958163
[(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 3-chloro-5-ethoxy-4-propoxybenzoate (PubChem CID 8958163) has the molecular formula C18H24ClNO5 and a molecular weight of 369.85 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 3-chloro-5-ethoxy-4-propoxybenzoate.
| Compound Name | [(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 3-chloro-5-ethoxy-4-propoxybenzoate |
|---|---|
| PubChem CID | 8958163 |
| Molecular Formula | C18H24ClNO5 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | [(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 3-chloro-5-ethoxy-4-propoxybenzoate |
| SMILES | C=CCNC(=O)[C@H](C)OC(=O)c1cc(Cl)c(OCCC)c(OCC)c1 |
| InChI | InChI=1S/C18H24ClNO5/c1-5-8-20-17(21)12(4)25-18(22)13-10-14(19)16(24-9-6-2)15(11-13)23-7-3/h5,10-12H,1,6-9H2,2-4H3,(H,20,21)/t12-/m0/s1 |
| InChIKey | KQOXIQHMWGKICX-LBPRGKRZSA-N |
| XLogP | 3.38 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|