C22H27ClN2O5 — CID 55311629
[1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 3-chloro-5-methoxy-4-propoxybenzoate (PubChem CID 55311629) has the molecular formula C22H27ClN2O5 and a molecular weight of 434.92 g/mol. Its IUPAC name is [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 3-chloro-5-methoxy-4-propoxybenzoate.
| Compound Name | [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 3-chloro-5-methoxy-4-propoxybenzoate |
|---|---|
| PubChem CID | 55311629 |
| Molecular Formula | C22H27ClN2O5 |
| Molecular Weight | 434.92 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 3-chloro-5-methoxy-4-propoxybenzoate |
| SMILES | CCCOc1c(Cl)cc(C(=O)OC(C)C(=O)Nc2ccc(N(C)C)cc2)cc1OC |
| InChI | InChI=1S/C22H27ClN2O5/c1-6-11-29-20-18(23)12-15(13-19(20)28-5)22(27)30-14(2)21(26)24-16-7-9-17(10-8-16)25(3)4/h7-10,12-14H,6,11H2,1-5H3,(H,24,26) |
| InChIKey | JHRWRSNDBQCQPE-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.92 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|