C19H27ClN2O6 — CID 7952401
[2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 4-butoxy-3-chloro-5-methoxybenzoate (PubChem CID 7952401) has the molecular formula C19H27ClN2O6 and a molecular weight of 414.89 g/mol. Its IUPAC name is [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 4-butoxy-3-chloro-5-methoxybenzoate.
| Compound Name | [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 4-butoxy-3-chloro-5-methoxybenzoate |
|---|---|
| PubChem CID | 7952401 |
| Molecular Formula | C19H27ClN2O6 |
| Molecular Weight | 414.89 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 4-butoxy-3-chloro-5-methoxybenzoate |
| SMILES | CCCCOc1c(Cl)cc(C(=O)OCC(=O)NC(=O)NCC(C)C)cc1OC |
| InChI | InChI=1S/C19H27ClN2O6/c1-5-6-7-27-17-14(20)8-13(9-15(17)26-4)18(24)28-11-16(23)22-19(25)21-10-12(2)3/h8-9,12H,5-7,10-11H2,1-4H3,(H2,21,22,23,25) |
| InChIKey | KPFPLDTVSSJVBT-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.89 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|