C20H20N4O4 — CID 11696578
4-[6-(3,4,5-trimethoxyanilino)pyrazin-2-yl]benzamide (PubChem CID 11696578) has the molecular formula C20H20N4O4 and a molecular weight of 380.40 g/mol. Its IUPAC name is 4-[6-(3,4,5-trimethoxyanilino)pyrazin-2-yl]benzamide.
| Compound Name | 4-[6-(3,4,5-trimethoxyanilino)pyrazin-2-yl]benzamide |
|---|---|
| PubChem CID | 11696578 |
| Molecular Formula | C20H20N4O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 4-[6-(3,4,5-trimethoxyanilino)pyrazin-2-yl]benzamide |
| SMILES | COc1cc(Nc2cncc(-c3ccc(C(N)=O)cc3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C20H20N4O4/c1-26-16-8-14(9-17(27-2)19(16)28-3)23-18-11-22-10-15(24-18)12-4-6-13(7-5-12)20(21)25/h4-11H,1-3H3,(H2,21,25)(H,23,24) |
| InChIKey | LZLKDDDQYGMZTB-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 108.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |