C20H17N5 — CID 10131417
6-methyl-2-phenyl-N-(5-phenyl-1H-pyrazol-3-yl)pyrimidin-4-amine (PubChem CID 10131417) has the molecular formula C20H17N5 and a molecular weight of 327.39 g/mol. Its IUPAC name is 6-methyl-2-phenyl-N-(5-phenyl-1H-pyrazol-3-yl)pyrimidin-4-amine.
| Compound Name | 6-methyl-2-phenyl-N-(5-phenyl-1H-pyrazol-3-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 10131417 |
| Molecular Formula | C20H17N5 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 6-methyl-2-phenyl-N-(5-phenyl-1H-pyrazol-3-yl)pyrimidin-4-amine |
| SMILES | Cc1cc(Nc2cc(-c3ccccc3)[nH]n2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C20H17N5/c1-14-12-18(23-20(21-14)16-10-6-3-7-11-16)22-19-13-17(24-25-19)15-8-4-2-5-9-15/h2-13H,1H3,(H2,21,22,23,24,25) |
| InChIKey | CIYDYDIDDPJYLP-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |