C21H17FN4S — CID 144988150
N-[5-(4-fluorophenyl)-1H-pyrazol-3-yl]-6-methyl-4-phenylsulfanylpyridin-2-amine (PubChem CID 144988150) has the molecular formula C21H17FN4S and a molecular weight of 376.46 g/mol. Its IUPAC name is N-[5-(4-fluorophenyl)-1H-pyrazol-3-yl]-6-methyl-4-phenylsulfanylpyridin-2-amine.
| Compound Name | N-[5-(4-fluorophenyl)-1H-pyrazol-3-yl]-6-methyl-4-phenylsulfanylpyridin-2-amine |
|---|---|
| PubChem CID | 144988150 |
| Molecular Formula | C21H17FN4S |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | N-[5-(4-fluorophenyl)-1H-pyrazol-3-yl]-6-methyl-4-phenylsulfanylpyridin-2-amine |
| SMILES | Cc1cc(Sc2ccccc2)cc(Nc2cc(-c3ccc(F)cc3)[nH]n2)n1 |
| InChI | InChI=1S/C21H17FN4S/c1-14-11-18(27-17-5-3-2-4-6-17)12-20(23-14)24-21-13-19(25-26-21)15-7-9-16(22)10-8-15/h2-13H,1H3,(H2,23,24,25,26) |
| InChIKey | CGWPTKWKFUHKIK-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |