C20H23N5S — CID 144988036
6-methyl-N-(5-phenyl-1H-pyrazol-3-yl)-4-piperidin-4-ylsulfanylpyridin-2-amine (PubChem CID 144988036) has the molecular formula C20H23N5S and a molecular weight of 365.51 g/mol. Its IUPAC name is 6-methyl-N-(5-phenyl-1H-pyrazol-3-yl)-4-piperidin-4-ylsulfanylpyridin-2-amine.
| Compound Name | 6-methyl-N-(5-phenyl-1H-pyrazol-3-yl)-4-piperidin-4-ylsulfanylpyridin-2-amine |
|---|---|
| PubChem CID | 144988036 |
| Molecular Formula | C20H23N5S |
| Molecular Weight | 365.51 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 6-methyl-N-(5-phenyl-1H-pyrazol-3-yl)-4-piperidin-4-ylsulfanylpyridin-2-amine |
| SMILES | Cc1cc(SC2CCNCC2)cc(Nc2cc(-c3ccccc3)[nH]n2)n1 |
| InChI | InChI=1S/C20H23N5S/c1-14-11-17(26-16-7-9-21-10-8-16)12-19(22-14)23-20-13-18(24-25-20)15-5-3-2-4-6-15/h2-6,11-13,16,21H,7-10H2,1H3,(H2,22,23,24,25) |
| InChIKey | LLHIXXQQRMYGEN-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.51 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |