C19H20ClN5S — CID 144988121
6-chloro-N-(5-phenyl-1H-pyrazol-3-yl)-4-piperidin-1-ylsulfanylpyridin-2-amine (PubChem CID 144988121) has the molecular formula C19H20ClN5S and a molecular weight of 385.92 g/mol. Its IUPAC name is 6-chloro-N-(5-phenyl-1H-pyrazol-3-yl)-4-piperidin-1-ylsulfanylpyridin-2-amine.
| Compound Name | 6-chloro-N-(5-phenyl-1H-pyrazol-3-yl)-4-piperidin-1-ylsulfanylpyridin-2-amine |
|---|---|
| PubChem CID | 144988121 |
| Molecular Formula | C19H20ClN5S |
| Molecular Weight | 385.92 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 6-chloro-N-(5-phenyl-1H-pyrazol-3-yl)-4-piperidin-1-ylsulfanylpyridin-2-amine |
| SMILES | Clc1cc(SN2CCCCC2)cc(Nc2cc(-c3ccccc3)[nH]n2)n1 |
| InChI | InChI=1S/C19H20ClN5S/c20-17-11-15(26-25-9-5-2-6-10-25)12-18(21-17)22-19-13-16(23-24-19)14-7-3-1-4-8-14/h1,3-4,7-8,11-13H,2,5-6,9-10H2,(H2,21,22,23,24) |
| InChIKey | LOLCZBPVRYQICU-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.92 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|