C22H28N6O3S — CID 118628195
3-[[6-[(5-phenyl-1H-pyrazol-3-yl)amino]-4-piperidin-1-ylsulfonyl-2-pyridinyl]amino]propan-1-ol (PubChem CID 118628195) has the molecular formula C22H28N6O3S and a molecular weight of 456.57 g/mol. Its IUPAC name is 3-[[6-[(5-phenyl-1H-pyrazol-3-yl)amino]-4-piperidin-1-ylsulfonyl-2-pyridinyl]amino]propan-1-ol.
| Compound Name | 3-[[6-[(5-phenyl-1H-pyrazol-3-yl)amino]-4-piperidin-1-ylsulfonyl-2-pyridinyl]amino]propan-1-ol |
|---|---|
| PubChem CID | 118628195 |
| Molecular Formula | C22H28N6O3S |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | 3-[[6-[(5-phenyl-1H-pyrazol-3-yl)amino]-4-piperidin-1-ylsulfonyl-2-pyridinyl]amino]propan-1-ol |
| SMILES | O=S(=O)(c1cc(NCCCO)nc(Nc2cc(-c3ccccc3)[nH]n2)c1)N1CCCCC1 |
| InChI | InChI=1S/C22H28N6O3S/c29-13-7-10-23-20-14-18(32(30,31)28-11-5-2-6-12-28)15-21(24-20)25-22-16-19(26-27-22)17-8-3-1-4-9-17/h1,3-4,8-9,14-16,29H,2,5-7,10-13H2,(H3,23,24,25,26,27) |
| InChIKey | IZEAAILWXMRMMR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 123.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|