C23H19N7 — CID 139220875
2-N,6-N-bis(5-phenyl-1H-pyrazol-3-yl)pyridine-2,6-diamine (PubChem CID 139220875) has the molecular formula C23H19N7 and a molecular weight of 393.45 g/mol. Its IUPAC name is 2-N,6-N-bis(5-phenyl-1H-pyrazol-3-yl)pyridine-2,6-diamine.
| Compound Name | 2-N,6-N-bis(5-phenyl-1H-pyrazol-3-yl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 139220875 |
| Molecular Formula | C23H19N7 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 2-N,6-N-bis(5-phenyl-1H-pyrazol-3-yl)pyridine-2,6-diamine |
| SMILES | c1ccc(-c2cc(Nc3cccc(Nc4cc(-c5ccccc5)[nH]n4)n3)n[nH]2)cc1 |
| InChI | InChI=1S/C23H19N7/c1-3-8-16(9-4-1)18-14-22(29-27-18)25-20-12-7-13-21(24-20)26-23-15-19(28-30-23)17-10-5-2-6-11-17/h1-15H,(H4,24,25,26,27,28,29,30) |
| InChIKey | HNSNOAJWOUPMGU-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |