C20H22Cl2N6 — CID 162315025
N,N'-bis(5-phenyl-1H-pyrazol-3-yl)ethane-1,2-diamine;dihydrochloride (PubChem CID 162315025) has the molecular formula C20H22Cl2N6 and a molecular weight of 417.34 g/mol. Its IUPAC name is N,N'-bis(5-phenyl-1H-pyrazol-3-yl)ethane-1,2-diamine;dihydrochloride.
| Compound Name | N,N'-bis(5-phenyl-1H-pyrazol-3-yl)ethane-1,2-diamine;dihydrochloride |
|---|---|
| PubChem CID | 162315025 |
| Molecular Formula | C20H22Cl2N6 |
| Molecular Weight | 417.34 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | N,N'-bis(5-phenyl-1H-pyrazol-3-yl)ethane-1,2-diamine;dihydrochloride |
| SMILES | Cl.Cl.c1ccc(-c2cc(NCCNc3cc(-c4ccccc4)[nH]n3)n[nH]2)cc1 |
| InChI | InChI=1S/C20H20N6.2ClH/c1-3-7-15(8-4-1)17-13-19(25-23-17)21-11-12-22-20-14-18(24-26-20)16-9-5-2-6-10-16;;/h1-10,13-14H,11-12H2,(H2,21,23,25)(H2,22,24,26);2*1H |
| InChIKey | DKRUTIUVEUBPFR-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.34 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|