C22H24N6 — CID 59363907
N,N'-bis[5-(4-methylphenyl)-1H-pyrazol-3-yl]ethane-1,2-diamine (PubChem CID 59363907) has the molecular formula C22H24N6 and a molecular weight of 372.48 g/mol. Its IUPAC name is N,N'-bis[5-(4-methylphenyl)-1H-pyrazol-3-yl]ethane-1,2-diamine.
| Compound Name | N,N'-bis[5-(4-methylphenyl)-1H-pyrazol-3-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 59363907 |
| Molecular Formula | C22H24N6 |
| Molecular Weight | 372.48 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | N,N'-bis[5-(4-methylphenyl)-1H-pyrazol-3-yl]ethane-1,2-diamine |
| SMILES | Cc1ccc(-c2cc(NCCNc3cc(-c4ccc(C)cc4)[nH]n3)n[nH]2)cc1 |
| InChI | InChI=1S/C22H24N6/c1-15-3-7-17(8-4-15)19-13-21(27-25-19)23-11-12-24-22-14-20(26-28-22)18-9-5-16(2)6-10-18/h3-10,13-14H,11-12H2,1-2H3,(H2,23,25,27)(H2,24,26,28) |
| InChIKey | NMUMMVFVBGAJIC-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.48 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|