C22H20ClN7O — CID 135199042
[6-chloro-4-[(5-phenyl-1H-pyrazol-3-yl)amino]quinazolin-2-yl]-piperazin-1-ylmethanone (PubChem CID 135199042) has the molecular formula C22H20ClN7O and a molecular weight of 433.90 g/mol. Its IUPAC name is [6-chloro-4-[(5-phenyl-1H-pyrazol-3-yl)amino]quinazolin-2-yl]-piperazin-1-ylmethanone.
| Compound Name | [6-chloro-4-[(5-phenyl-1H-pyrazol-3-yl)amino]quinazolin-2-yl]-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 135199042 |
| Molecular Formula | C22H20ClN7O |
| Molecular Weight | 433.90 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | [6-chloro-4-[(5-phenyl-1H-pyrazol-3-yl)amino]quinazolin-2-yl]-piperazin-1-ylmethanone |
| SMILES | O=C(c1nc(Nc2cc(-c3ccccc3)[nH]n2)c2cc(Cl)ccc2n1)N1CCNCC1 |
| InChI | InChI=1S/C22H20ClN7O/c23-15-6-7-17-16(12-15)20(27-21(25-17)22(31)30-10-8-24-9-11-30)26-19-13-18(28-29-19)14-4-2-1-3-5-14/h1-7,12-13,24H,8-11H2,(H2,25,26,27,28,29) |
| InChIKey | NNBGVCMPADTOET-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.90 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |