C26H32ClN7O3 — CID 150850914
pentyl (2R)-4-[6-chloro-4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]quinazoline-2-carbonyl]-2-methylpiperazine-1-carboxylate (PubChem CID 150850914) has the molecular formula C26H32ClN7O3 and a molecular weight of 526.04 g/mol. Its IUPAC name is pentyl (2R)-4-[6-chloro-4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]quinazoline-2-carbonyl]-2-methylpiperazine-1-carboxylate.
| Compound Name | pentyl (2R)-4-[6-chloro-4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]quinazoline-2-carbonyl]-2-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 150850914 |
| Molecular Formula | C26H32ClN7O3 |
| Molecular Weight | 526.04 g/mol |
| Exact Mass | 525.23 |
| IUPAC Name | pentyl (2R)-4-[6-chloro-4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]quinazoline-2-carbonyl]-2-methylpiperazine-1-carboxylate |
| SMILES | CCCCCOC(=O)N1CCN(C(=O)c2nc(Nc3cc(C4CC4)[nH]n3)c3cc(Cl)ccc3n2)C[C@H]1C |
| InChI | InChI=1S/C26H32ClN7O3/c1-3-4-5-12-37-26(36)34-11-10-33(15-16(34)2)25(35)24-28-20-9-8-18(27)13-19(20)23(30-24)29-22-14-21(31-32-22)17-6-7-17/h8-9,13-14,16-17H,3-7,10-12,15H2,1-2H3,(H2,28,29,30,31,32)/t16-/m1/s1 |
| InChIKey | KPZXPSWJTJVNFX-MRXNPFEDSA-N |
| XLogP | 5.10 |
| TPSA | 116.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.04 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|