C32H36ClN7O2 — CID 162728600
[6-[2-(5-chloro-2-hydroxy-2-adamantyl)ethynyl]-4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]quinazolin-2-yl]-[(3R)-3-methylpiperazin-1-yl]methanone (PubChem CID 162728600) has the molecular formula C32H36ClN7O2 and a molecular weight of 586.14 g/mol. Its IUPAC name is [6-[2-(5-chloro-2-hydroxy-2-adamantyl)ethynyl]-4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]quinazolin-2-yl]-[(3R)-3-methylpiperazin-1-yl]methanone.
| Compound Name | [6-[2-(5-chloro-2-hydroxy-2-adamantyl)ethynyl]-4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]quinazolin-2-yl]-[(3R)-3-methylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 162728600 |
| Molecular Formula | C32H36ClN7O2 |
| Molecular Weight | 586.14 g/mol |
| Exact Mass | 585.26 |
| IUPAC Name | [6-[2-(5-chloro-2-hydroxy-2-adamantyl)ethynyl]-4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]quinazolin-2-yl]-[(3R)-3-methylpiperazin-1-yl]methanone |
| SMILES | C[C@@H]1CN(C(=O)c2nc(Nc3cc(C4CC4)[nH]n3)c3cc(C#CC4(O)C5CC6CC4CC(Cl)(C6)C5)ccc3n2)CCN1 |
| InChI | InChI=1S/C32H36ClN7O2/c1-18-17-40(9-8-34-18)30(41)29-35-25-5-2-19(6-7-32(42)22-10-20-11-23(32)16-31(33,14-20)15-22)12-24(25)28(37-29)36-27-13-26(38-39-27)21-3-4-21/h2,5,12-13,18,20-23,34,42H,3-4,8-11,14-17H2,1H3,(H2,35,36,37,38,39)/t18-,20?,22?,23?,31?,32?/m1/s1 |
| InChIKey | NTPAWFODJKGZDM-PAMAJJBDSA-N |
| XLogP | 4.31 |
| TPSA | 119.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.14 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|