C28H25ClN2O — CID 17250380
(4-benzylpiperidin-1-yl)-(6-chloro-2-phenylquinolin-4-yl)methanone (PubChem CID 17250380) has the molecular formula C28H25ClN2O and a molecular weight of 440.97 g/mol. Its IUPAC name is (4-benzylpiperidin-1-yl)-(6-chloro-2-phenylquinolin-4-yl)methanone.
| Compound Name | (4-benzylpiperidin-1-yl)-(6-chloro-2-phenylquinolin-4-yl)methanone |
|---|---|
| PubChem CID | 17250380 |
| Molecular Formula | C28H25ClN2O |
| Molecular Weight | 440.97 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | (4-benzylpiperidin-1-yl)-(6-chloro-2-phenylquinolin-4-yl)methanone |
| SMILES | O=C(c1cc(-c2ccccc2)nc2ccc(Cl)cc12)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C28H25ClN2O/c29-23-11-12-26-24(18-23)25(19-27(30-26)22-9-5-2-6-10-22)28(32)31-15-13-21(14-16-31)17-20-7-3-1-4-8-20/h1-12,18-19,21H,13-17H2 |
| InChIKey | DWRDGRNZULGGBC-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.97 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |