C28H24Cl2N2O — CID 4626628
(4-benzylpiperidin-1-yl)-[2-(3,4-dichlorophenyl)quinolin-4-yl]methanone (PubChem CID 4626628) has the molecular formula C28H24Cl2N2O and a molecular weight of 475.42 g/mol. Its IUPAC name is (4-benzylpiperidin-1-yl)-[2-(3,4-dichlorophenyl)quinolin-4-yl]methanone.
| Compound Name | (4-benzylpiperidin-1-yl)-[2-(3,4-dichlorophenyl)quinolin-4-yl]methanone |
|---|---|
| PubChem CID | 4626628 |
| Molecular Formula | C28H24Cl2N2O |
| Molecular Weight | 475.42 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | (4-benzylpiperidin-1-yl)-[2-(3,4-dichlorophenyl)quinolin-4-yl]methanone |
| SMILES | O=C(c1cc(-c2ccc(Cl)c(Cl)c2)nc2ccccc12)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C28H24Cl2N2O/c29-24-11-10-21(17-25(24)30)27-18-23(22-8-4-5-9-26(22)31-27)28(33)32-14-12-20(13-15-32)16-19-6-2-1-3-7-19/h1-11,17-18,20H,12-16H2 |
| InChIKey | RKLVWGXMODYQTL-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.42 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |