C12H18N2S — CID 102925601
2,4-dimethyl-6-piperidin-4-ylsulfanylpyridine (PubChem CID 102925601) has the molecular formula C12H18N2S and a molecular weight of 222.36 g/mol. Its IUPAC name is 2,4-dimethyl-6-piperidin-4-ylsulfanylpyridine.
| Compound Name | 2,4-dimethyl-6-piperidin-4-ylsulfanylpyridine |
|---|---|
| PubChem CID | 102925601 |
| Molecular Formula | C12H18N2S |
| Molecular Weight | 222.36 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 2,4-dimethyl-6-piperidin-4-ylsulfanylpyridine |
| SMILES | Cc1cc(C)nc(SC2CCNCC2)c1 |
| InChI | InChI=1S/C12H18N2S/c1-9-7-10(2)14-12(8-9)15-11-3-5-13-6-4-11/h7-8,11,13H,3-6H2,1-2H3 |
| InChIKey | VWJKMUHVCVLQML-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |