C9H12ClN3S — CID 71639266
4-chloro-6-methyl-2-pyrrolidin-3-ylsulfanylpyrimidine (PubChem CID 71639266) has the molecular formula C9H12ClN3S and a molecular weight of 229.74 g/mol. Its IUPAC name is 4-chloro-6-methyl-2-pyrrolidin-3-ylsulfanylpyrimidine.
| Compound Name | 4-chloro-6-methyl-2-pyrrolidin-3-ylsulfanylpyrimidine |
|---|---|
| PubChem CID | 71639266 |
| Molecular Formula | C9H12ClN3S |
| Molecular Weight | 229.74 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | 4-chloro-6-methyl-2-pyrrolidin-3-ylsulfanylpyrimidine |
| SMILES | Cc1cc(Cl)nc(SC2CCNC2)n1 |
| InChI | InChI=1S/C9H12ClN3S/c1-6-4-8(10)13-9(12-6)14-7-2-3-11-5-7/h4,7,11H,2-3,5H2,1H3 |
| InChIKey | PSDXBVXAPSDHKH-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.74 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |