C10H16N2OS — CID 130490292
2-(azepan-4-ylsulfanyl)-4-methyl-1,3-oxazole (PubChem CID 130490292) has the molecular formula C10H16N2OS and a molecular weight of 212.32 g/mol. Its IUPAC name is 2-(azepan-4-ylsulfanyl)-4-methyl-1,3-oxazole.
| Compound Name | 2-(azepan-4-ylsulfanyl)-4-methyl-1,3-oxazole |
|---|---|
| PubChem CID | 130490292 |
| Molecular Formula | C10H16N2OS |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 2-(azepan-4-ylsulfanyl)-4-methyl-1,3-oxazole |
| SMILES | Cc1coc(SC2CCCNCC2)n1 |
| InChI | InChI=1S/C10H16N2OS/c1-8-7-13-10(12-8)14-9-3-2-5-11-6-4-9/h7,9,11H,2-6H2,1H3 |
| InChIKey | VYLVRJMOWZHCPT-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |