C10H15ClN2S — CID 71639006
4-methyl-2-[(3R)-pyrrolidin-3-yl]sulfanylpyridine;hydrochloride (PubChem CID 71639006) has the molecular formula C10H15ClN2S and a molecular weight of 230.76 g/mol. Its IUPAC name is 4-methyl-2-[(3R)-pyrrolidin-3-yl]sulfanylpyridine;hydrochloride.
| Compound Name | 4-methyl-2-[(3R)-pyrrolidin-3-yl]sulfanylpyridine;hydrochloride |
|---|---|
| PubChem CID | 71639006 |
| Molecular Formula | C10H15ClN2S |
| Molecular Weight | 230.76 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 4-methyl-2-[(3R)-pyrrolidin-3-yl]sulfanylpyridine;hydrochloride |
| SMILES | Cc1ccnc(S[C@@H]2CCNC2)c1.Cl |
| InChI | InChI=1S/C10H14N2S.ClH/c1-8-2-5-12-10(6-8)13-9-3-4-11-7-9;/h2,5-6,9,11H,3-4,7H2,1H3;1H/t9-;/m1./s1 |
| InChIKey | AYWLOQRJNFDAEP-SBSPUUFOSA-N |
| XLogP | 2.27 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.76 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |