C12H20N2 — CID 143900241
ethane;4-methyl-2-pyrrolidin-3-ylpyridine (PubChem CID 143900241) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is ethane;4-methyl-2-pyrrolidin-3-ylpyridine.
| Compound Name | ethane;4-methyl-2-pyrrolidin-3-ylpyridine |
|---|---|
| PubChem CID | 143900241 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | ethane;4-methyl-2-pyrrolidin-3-ylpyridine |
| SMILES | CC.Cc1ccnc(C2CCNC2)c1 |
| InChI | InChI=1S/C10H14N2.C2H6/c1-8-2-5-12-10(6-8)9-3-4-11-7-9;1-2/h2,5-6,9,11H,3-4,7H2,1H3;1-2H3 |
| InChIKey | BPKXAGALAYOUDX-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |