C10H16N4 — CID 92615182
N,N-dimethyl-4-[(3S)-pyrrolidin-3-yl]pyrimidin-2-amine (PubChem CID 92615182) has the molecular formula C10H16N4 and a molecular weight of 192.27 g/mol. Its IUPAC name is N,N-dimethyl-4-[(3S)-pyrrolidin-3-yl]pyrimidin-2-amine.
| Compound Name | N,N-dimethyl-4-[(3S)-pyrrolidin-3-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 92615182 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | N,N-dimethyl-4-[(3S)-pyrrolidin-3-yl]pyrimidin-2-amine |
| SMILES | CN(C)c1nccc([C@H]2CCNC2)n1 |
| InChI | InChI=1S/C10H16N4/c1-14(2)10-12-6-4-9(13-10)8-3-5-11-7-8/h4,6,8,11H,3,5,7H2,1-2H3/t8-/m0/s1 |
| InChIKey | XCASHPSQIVOHLJ-QMMMGPOBSA-N |
| XLogP | 0.62 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |