C12H13N3 — CID 124702274
2-[(3S)-pyrrolidin-3-yl]-1,8-naphthyridine (PubChem CID 124702274) has the molecular formula C12H13N3 and a molecular weight of 199.26 g/mol. Its IUPAC name is 2-[(3S)-pyrrolidin-3-yl]-1,8-naphthyridine.
| Compound Name | 2-[(3S)-pyrrolidin-3-yl]-1,8-naphthyridine |
|---|---|
| PubChem CID | 124702274 |
| Molecular Formula | C12H13N3 |
| Molecular Weight | 199.26 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 2-[(3S)-pyrrolidin-3-yl]-1,8-naphthyridine |
| SMILES | c1cnc2nc([C@H]3CCNC3)ccc2c1 |
| InChI | InChI=1S/C12H13N3/c1-2-9-3-4-11(10-5-7-13-8-10)15-12(9)14-6-1/h1-4,6,10,13H,5,7-8H2/t10-/m0/s1 |
| InChIKey | RPRSTNQODVPNHB-JTQLQIEISA-N |
| XLogP | 1.71 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.26 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |