C11H13N3 — CID 24759625
2-pyrrolidin-3-yl-1H-pyrrolo[3,2-b]pyridine (PubChem CID 24759625) has the molecular formula C11H13N3 and a molecular weight of 187.25 g/mol. Its IUPAC name is 2-pyrrolidin-3-yl-1H-pyrrolo[3,2-b]pyridine.
| Compound Name | 2-pyrrolidin-3-yl-1H-pyrrolo[3,2-b]pyridine |
|---|---|
| PubChem CID | 24759625 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 2-pyrrolidin-3-yl-1H-pyrrolo[3,2-b]pyridine |
| SMILES | c1cnc2cc(C3CCNC3)[nH]c2c1 |
| InChI | InChI=1S/C11H13N3/c1-2-9-11(13-4-1)6-10(14-9)8-3-5-12-7-8/h1-2,4,6,8,12,14H,3,5,7H2 |
| InChIKey | NUZPLGPQBGJPBA-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |