C15H14ClN3 — CID 154791527
2-(azetidin-3-yl)-1,10-phenanthroline;hydrochloride (PubChem CID 154791527) has the molecular formula C15H14ClN3 and a molecular weight of 271.75 g/mol. Its IUPAC name is 2-(azetidin-3-yl)-1,10-phenanthroline;hydrochloride.
| Compound Name | 2-(azetidin-3-yl)-1,10-phenanthroline;hydrochloride |
|---|---|
| PubChem CID | 154791527 |
| Molecular Formula | C15H14ClN3 |
| Molecular Weight | 271.75 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 2-(azetidin-3-yl)-1,10-phenanthroline;hydrochloride |
| SMILES | Cl.c1cnc2c(c1)ccc1ccc(C3CNC3)nc12 |
| InChI | InChI=1S/C15H13N3.ClH/c1-2-10-3-4-11-5-6-13(12-8-16-9-12)18-15(11)14(10)17-7-1;/h1-7,12,16H,8-9H2;1H |
| InChIKey | GVLDRNOCKGYWIA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.75 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|