C17H10F6N4 — CID 131966789
2-[4,5-bis(trifluoromethyl)-2,3-dihydro-1H-imidazol-2-yl]-1,10-phenanthroline (PubChem CID 131966789) has the molecular formula C17H10F6N4 and a molecular weight of 384.28 g/mol. Its IUPAC name is 2-[4,5-bis(trifluoromethyl)-2,3-dihydro-1H-imidazol-2-yl]-1,10-phenanthroline.
| Compound Name | 2-[4,5-bis(trifluoromethyl)-2,3-dihydro-1H-imidazol-2-yl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 131966789 |
| Molecular Formula | C17H10F6N4 |
| Molecular Weight | 384.28 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | 2-[4,5-bis(trifluoromethyl)-2,3-dihydro-1H-imidazol-2-yl]-1,10-phenanthroline |
| SMILES | FC(F)(F)C1=C(C(F)(F)F)NC(c2ccc3ccc4cccnc4c3n2)N1 |
| InChI | InChI=1S/C17H10F6N4/c18-16(19,20)13-14(17(21,22)23)27-15(26-13)10-6-5-9-4-3-8-2-1-7-24-11(8)12(9)25-10/h1-7,15,26-27H |
| InChIKey | GWXSIZHTVOBKEB-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.28 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|