C19H20N2O2 — CID 171054646
2-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)-1,10-phenanthroline (PubChem CID 171054646) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is 2-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)-1,10-phenanthroline.
| Compound Name | 2-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)-1,10-phenanthroline |
|---|---|
| PubChem CID | 171054646 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 2-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)-1,10-phenanthroline |
| SMILES | CC1(C)OC(c2ccc3ccc4cccnc4c3n2)OC1(C)C |
| InChI | InChI=1S/C19H20N2O2/c1-18(2)19(3,4)23-17(22-18)14-10-9-13-8-7-12-6-5-11-20-15(12)16(13)21-14/h5-11,17H,1-4H3 |
| InChIKey | DXKNBHAHTTXURB-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|