C21H22N2 — CID 101223235
2-[(1S,2S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]-1,10-phenanthroline (PubChem CID 101223235) has the molecular formula C21H22N2 and a molecular weight of 302.42 g/mol. Its IUPAC name is 2-[(1S,2S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]-1,10-phenanthroline.
| Compound Name | 2-[(1S,2S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 101223235 |
| Molecular Formula | C21H22N2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | 2-[(1S,2S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]-1,10-phenanthroline |
| SMILES | CC1(C)[C@H]2CC[C@H](c3ccc4ccc5cccnc5c4n3)[C@@H]1C2 |
| InChI | InChI=1S/C21H22N2/c1-21(2)15-8-9-16(17(21)12-15)18-10-7-14-6-5-13-4-3-11-22-19(13)20(14)23-18/h3-7,10-11,15-17H,8-9,12H2,1-2H3/t15-,16-,17-/m0/s1 |
| InChIKey | FFHBKVIWRQWKCB-ULQDDVLXSA-N |
| XLogP | 5.32 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|