C14H8CuF5N2 — CID 118415323
copper(1+);1,1,1,2,2-pentafluoroethane;1,10-phenanthroline (PubChem CID 118415323) has the molecular formula C14H8CuF5N2 and a molecular weight of 362.77 g/mol. Its IUPAC name is copper(1+);1,1,1,2,2-pentafluoroethane;1,10-phenanthroline.
| Compound Name | copper(1+);1,1,1,2,2-pentafluoroethane;1,10-phenanthroline |
|---|---|
| PubChem CID | 118415323 |
| Molecular Formula | C14H8CuF5N2 |
| Molecular Weight | 362.77 g/mol |
| Exact Mass | 361.99 |
| IUPAC Name | copper(1+);1,1,1,2,2-pentafluoroethane;1,10-phenanthroline |
| SMILES | F[C-](F)C(F)(F)F.[Cu+].c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C12H8N2.C2F5.Cu/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;3-1(4)2(5,6)7;/h1-8H;;/q;-1;+1 |
| InChIKey | RPWQLZAIIYQLQK-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.77 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|