C10H11N3S — CID 71643728
2-pyrrolidin-3-ylsulfanylpyridine-4-carbonitrile (PubChem CID 71643728) has the molecular formula C10H11N3S and a molecular weight of 205.29 g/mol. Its IUPAC name is 2-pyrrolidin-3-ylsulfanylpyridine-4-carbonitrile.
| Compound Name | 2-pyrrolidin-3-ylsulfanylpyridine-4-carbonitrile |
|---|---|
| PubChem CID | 71643728 |
| Molecular Formula | C10H11N3S |
| Molecular Weight | 205.29 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 2-pyrrolidin-3-ylsulfanylpyridine-4-carbonitrile |
| SMILES | N#Cc1ccnc(SC2CCNC2)c1 |
| InChI | InChI=1S/C10H11N3S/c11-6-8-1-4-13-10(5-8)14-9-2-3-12-7-9/h1,4-5,9,12H,2-3,7H2 |
| InChIKey | KARNLNLRXXECQB-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.29 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |