C25H28N6O2 — CID 70214730
6-methoxy-N-(5-phenyl-1H-pyrazol-3-yl)-7-(1-piperidin-4-ylethoxy)quinazolin-4-amine (PubChem CID 70214730) has the molecular formula C25H28N6O2 and a molecular weight of 444.54 g/mol. Its IUPAC name is 6-methoxy-N-(5-phenyl-1H-pyrazol-3-yl)-7-(1-piperidin-4-ylethoxy)quinazolin-4-amine.
| Compound Name | 6-methoxy-N-(5-phenyl-1H-pyrazol-3-yl)-7-(1-piperidin-4-ylethoxy)quinazolin-4-amine |
|---|---|
| PubChem CID | 70214730 |
| Molecular Formula | C25H28N6O2 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | 6-methoxy-N-(5-phenyl-1H-pyrazol-3-yl)-7-(1-piperidin-4-ylethoxy)quinazolin-4-amine |
| SMILES | COc1cc2c(Nc3cc(-c4ccccc4)[nH]n3)ncnc2cc1OC(C)C1CCNCC1 |
| InChI | InChI=1S/C25H28N6O2/c1-16(17-8-10-26-11-9-17)33-23-13-21-19(12-22(23)32-2)25(28-15-27-21)29-24-14-20(30-31-24)18-6-4-3-5-7-18/h3-7,12-17,26H,8-11H2,1-2H3,(H2,27,28,29,30,31) |
| InChIKey | QUTSNWOSLZVAMR-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 96.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |