C31H42N6O4 — CID 91465029
tert-butyl 2-[[(2,6-dimethylanilino)-[[6-methoxy-7-(1-piperidin-4-ylethoxy)quinazolin-4-yl]amino]methylidene]amino]acetate (PubChem CID 91465029) has the molecular formula C31H42N6O4 and a molecular weight of 562.72 g/mol. Its IUPAC name is tert-butyl 2-[[(2,6-dimethylanilino)-[[6-methoxy-7-(1-piperidin-4-ylethoxy)quinazolin-4-yl]amino]methylidene]amino]acetate.
| Compound Name | tert-butyl 2-[[(2,6-dimethylanilino)-[[6-methoxy-7-(1-piperidin-4-ylethoxy)quinazolin-4-yl]amino]methylidene]amino]acetate |
|---|---|
| PubChem CID | 91465029 |
| Molecular Formula | C31H42N6O4 |
| Molecular Weight | 562.72 g/mol |
| Exact Mass | 562.33 |
| IUPAC Name | tert-butyl 2-[[(2,6-dimethylanilino)-[[6-methoxy-7-(1-piperidin-4-ylethoxy)quinazolin-4-yl]amino]methylidene]amino]acetate |
| SMILES | COc1cc2c(N/C(=N\CC(=O)OC(C)(C)C)Nc3c(C)cccc3C)ncnc2cc1OC(C)C1CCNCC1 |
| InChI | InChI=1S/C31H42N6O4/c1-19-9-8-10-20(2)28(19)36-30(33-17-27(38)41-31(4,5)6)37-29-23-15-25(39-7)26(16-24(23)34-18-35-29)40-21(3)22-11-13-32-14-12-22/h8-10,15-16,18,21-22,32H,11-14,17H2,1-7H3,(H2,33,34,35,36,37) |
| InChIKey | BDVCYKQMIVKATN-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 118.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.72 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|