C27H37N7O2 — CID 22243855
2-(2-aminoethyl)-1-(2,6-dimethylphenyl)-3-[6-methoxy-7-[(1-methylpiperidin-4-yl)methoxy]quinazolin-4-yl]guanidine (PubChem CID 22243855) has the molecular formula C27H37N7O2 and a molecular weight of 491.64 g/mol. Its IUPAC name is 2-(2-aminoethyl)-1-(2,6-dimethylphenyl)-3-[6-methoxy-7-[(1-methylpiperidin-4-yl)methoxy]quinazolin-4-yl]guanidine.
| Compound Name | 2-(2-aminoethyl)-1-(2,6-dimethylphenyl)-3-[6-methoxy-7-[(1-methylpiperidin-4-yl)methoxy]quinazolin-4-yl]guanidine |
|---|---|
| PubChem CID | 22243855 |
| Molecular Formula | C27H37N7O2 |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.30 |
| IUPAC Name | 2-(2-aminoethyl)-1-(2,6-dimethylphenyl)-3-[6-methoxy-7-[(1-methylpiperidin-4-yl)methoxy]quinazolin-4-yl]guanidine |
| SMILES | COc1cc2c(N/C(=N\CCN)Nc3c(C)cccc3C)ncnc2cc1OCC1CCN(C)CC1 |
| InChI | InChI=1S/C27H37N7O2/c1-18-6-5-7-19(2)25(18)32-27(29-11-10-28)33-26-21-14-23(35-4)24(15-22(21)30-17-31-26)36-16-20-8-12-34(3)13-9-20/h5-7,14-15,17,20H,8-13,16,28H2,1-4H3,(H2,29,30,31,32,33) |
| InChIKey | QGMKYFPSXWFMLO-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 109.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|