C28H38ClN7O2 — CID 22243905
1-(2-chloro-6-methylphenyl)-3-[6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-yl]-2-[3-(methylamino)propyl]guanidine (PubChem CID 22243905) has the molecular formula C28H38ClN7O2 and a molecular weight of 540.11 g/mol. Its IUPAC name is 1-(2-chloro-6-methylphenyl)-3-[6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-yl]-2-[3-(methylamino)propyl]guanidine.
| Compound Name | 1-(2-chloro-6-methylphenyl)-3-[6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-yl]-2-[3-(methylamino)propyl]guanidine |
|---|---|
| PubChem CID | 22243905 |
| Molecular Formula | C28H38ClN7O2 |
| Molecular Weight | 540.11 g/mol |
| Exact Mass | 539.28 |
| IUPAC Name | 1-(2-chloro-6-methylphenyl)-3-[6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-yl]-2-[3-(methylamino)propyl]guanidine |
| SMILES | CNCCC/N=C(/Nc1c(C)cccc1Cl)Nc1ncnc2cc(OCCCN3CCCC3)c(OC)cc12 |
| InChI | InChI=1S/C28H38ClN7O2/c1-20-9-6-10-22(29)26(20)34-28(31-12-7-11-30-2)35-27-21-17-24(37-3)25(18-23(21)32-19-33-27)38-16-8-15-36-13-4-5-14-36/h6,9-10,17-19,30H,4-5,7-8,11-16H2,1-3H3,(H2,31,32,33,34,35) |
| InChIKey | OCIZWOALQPSHLW-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 95.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.11 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|