C25H30F2N6O3 — CID 22649224
1-[7-[3-[4-(aminomethyl)piperidin-1-yl]propoxy]-6-methoxyquinazolin-4-yl]-3-(2,6-difluorophenyl)urea (PubChem CID 22649224) has the molecular formula C25H30F2N6O3 and a molecular weight of 500.55 g/mol. Its IUPAC name is 1-[7-[3-[4-(aminomethyl)piperidin-1-yl]propoxy]-6-methoxyquinazolin-4-yl]-3-(2,6-difluorophenyl)urea.
| Compound Name | 1-[7-[3-[4-(aminomethyl)piperidin-1-yl]propoxy]-6-methoxyquinazolin-4-yl]-3-(2,6-difluorophenyl)urea |
|---|---|
| PubChem CID | 22649224 |
| Molecular Formula | C25H30F2N6O3 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | 1-[7-[3-[4-(aminomethyl)piperidin-1-yl]propoxy]-6-methoxyquinazolin-4-yl]-3-(2,6-difluorophenyl)urea |
| SMILES | COc1cc2c(NC(=O)Nc3c(F)cccc3F)ncnc2cc1OCCCN1CCC(CN)CC1 |
| InChI | InChI=1S/C25H30F2N6O3/c1-35-21-12-17-20(13-22(21)36-11-3-8-33-9-6-16(14-28)7-10-33)29-15-30-24(17)32-25(34)31-23-18(26)4-2-5-19(23)27/h2,4-5,12-13,15-16H,3,6-11,14,28H2,1H3,(H2,29,30,31,32,34) |
| InChIKey | YOTFEWSFCDGNNL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 114.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|