C30H37FN6O4S — CID 143609189
3-fluoro-N-methylaniline;2-[2-[[7-[3-[4-(hydroxymethyl)piperidin-1-yl]propoxy]-6-methoxyquinazolin-4-yl]amino]-1,3-thiazol-5-yl]acetaldehyde (PubChem CID 143609189) has the molecular formula C30H37FN6O4S and a molecular weight of 596.73 g/mol. Its IUPAC name is 3-fluoro-N-methylaniline;2-[2-[[7-[3-[4-(hydroxymethyl)piperidin-1-yl]propoxy]-6-methoxyquinazolin-4-yl]amino]-1,3-thiazol-5-yl]acetaldehyde.
| Compound Name | 3-fluoro-N-methylaniline;2-[2-[[7-[3-[4-(hydroxymethyl)piperidin-1-yl]propoxy]-6-methoxyquinazolin-4-yl]amino]-1,3-thiazol-5-yl]acetaldehyde |
|---|---|
| PubChem CID | 143609189 |
| Molecular Formula | C30H37FN6O4S |
| Molecular Weight | 596.73 g/mol |
| Exact Mass | 596.26 |
| IUPAC Name | 3-fluoro-N-methylaniline;2-[2-[[7-[3-[4-(hydroxymethyl)piperidin-1-yl]propoxy]-6-methoxyquinazolin-4-yl]amino]-1,3-thiazol-5-yl]acetaldehyde |
| SMILES | CNc1cccc(F)c1.COc1cc2c(Nc3ncc(CC=O)s3)ncnc2cc1OCCCN1CCC(CO)CC1 |
| InChI | InChI=1S/C23H29N5O4S.C7H8FN/c1-31-20-11-18-19(25-15-26-22(18)27-23-24-13-17(33-23)5-9-29)12-21(20)32-10-2-6-28-7-3-16(14-30)4-8-28;1-9-7-4-2-3-6(8)5-7/h9,11-13,15-16,30H,2-8,10,14H2,1H3,(H,24,25,26,27);2-5,9H,1H3 |
| InChIKey | PSZCDEQPZBOVOX-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 121.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.73 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|