C28H34FN7O4S — CID 143389758
N-(3-fluorophenyl)-2-[2-[[6-[4-[4-(hydroxymethyl)piperidin-1-yl]butoxy]-5-methoxypyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]-1,3-thiazol-5-yl]acetamide (PubChem CID 143389758) has the molecular formula C28H34FN7O4S and a molecular weight of 583.69 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2-[2-[[6-[4-[4-(hydroxymethyl)piperidin-1-yl]butoxy]-5-methoxypyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]-1,3-thiazol-5-yl]acetamide.
| Compound Name | N-(3-fluorophenyl)-2-[2-[[6-[4-[4-(hydroxymethyl)piperidin-1-yl]butoxy]-5-methoxypyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]-1,3-thiazol-5-yl]acetamide |
|---|---|
| PubChem CID | 143389758 |
| Molecular Formula | C28H34FN7O4S |
| Molecular Weight | 583.69 g/mol |
| Exact Mass | 583.24 |
| IUPAC Name | N-(3-fluorophenyl)-2-[2-[[6-[4-[4-(hydroxymethyl)piperidin-1-yl]butoxy]-5-methoxypyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]-1,3-thiazol-5-yl]acetamide |
| SMILES | COc1c(OCCCCN2CCC(CO)CC2)cn2ncnc(Nc3ncc(CC(=O)Nc4cccc(F)c4)s3)c12 |
| InChI | InChI=1S/C28H34FN7O4S/c1-39-26-23(40-12-3-2-9-35-10-7-19(17-37)8-11-35)16-36-25(26)27(31-18-32-36)34-28-30-15-22(41-28)14-24(38)33-21-6-4-5-20(29)13-21/h4-6,13,15-16,18-19,37H,2-3,7-12,14,17H2,1H3,(H,33,38)(H,30,31,32,34) |
| InChIKey | CWGMPQVVLZUDIZ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 126.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.69 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|