C27H30FN6O7PS — CID 10394271
[1-[3-[4-[[5-[2-(3-fluoroanilino)-2-oxoethyl]-1,3-thiazol-2-yl]amino]-6-methoxyquinazolin-7-yl]oxypropyl]pyrrolidin-3-yl] dihydrogen phosphate (PubChem CID 10394271) has the molecular formula C27H30FN6O7PS and a molecular weight of 632.61 g/mol. Its IUPAC name is [1-[3-[4-[[5-[2-(3-fluoroanilino)-2-oxoethyl]-1,3-thiazol-2-yl]amino]-6-methoxyquinazolin-7-yl]oxypropyl]pyrrolidin-3-yl] dihydrogen phosphate.
| Compound Name | [1-[3-[4-[[5-[2-(3-fluoroanilino)-2-oxoethyl]-1,3-thiazol-2-yl]amino]-6-methoxyquinazolin-7-yl]oxypropyl]pyrrolidin-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 10394271 |
| Molecular Formula | C27H30FN6O7PS |
| Molecular Weight | 632.61 g/mol |
| Exact Mass | 632.16 |
| IUPAC Name | [1-[3-[4-[[5-[2-(3-fluoroanilino)-2-oxoethyl]-1,3-thiazol-2-yl]amino]-6-methoxyquinazolin-7-yl]oxypropyl]pyrrolidin-3-yl] dihydrogen phosphate |
| SMILES | COc1cc2c(Nc3ncc(CC(=O)Nc4cccc(F)c4)s3)ncnc2cc1OCCCN1CCC(OP(=O)(O)O)C1 |
| InChI | InChI=1S/C27H30FN6O7PS/c1-39-23-12-21-22(13-24(23)40-9-3-7-34-8-6-19(15-34)41-42(36,37)38)30-16-31-26(21)33-27-29-14-20(43-27)11-25(35)32-18-5-2-4-17(28)10-18/h2,4-5,10,12-14,16,19H,3,6-9,11,15H2,1H3,(H,32,35)(H2,36,37,38)(H,29,30,31,33) |
| InChIKey | WFIZWRJQRXALTJ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 168.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.61 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|