C30H36FN6O7PS — CID 10417078
2-[1-[3-[4-[[5-[2-(2-fluoroanilino)-2-oxoethyl]-1,3-thiazol-2-yl]amino]-6-methoxyquinazolin-7-yl]oxypropyl]piperidin-2-yl]ethyl dihydrogen phosphate (PubChem CID 10417078) has the molecular formula C30H36FN6O7PS and a molecular weight of 674.69 g/mol. Its IUPAC name is 2-[1-[3-[4-[[5-[2-(2-fluoroanilino)-2-oxoethyl]-1,3-thiazol-2-yl]amino]-6-methoxyquinazolin-7-yl]oxypropyl]piperidin-2-yl]ethyl dihydrogen phosphate.
| Compound Name | 2-[1-[3-[4-[[5-[2-(2-fluoroanilino)-2-oxoethyl]-1,3-thiazol-2-yl]amino]-6-methoxyquinazolin-7-yl]oxypropyl]piperidin-2-yl]ethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 10417078 |
| Molecular Formula | C30H36FN6O7PS |
| Molecular Weight | 674.69 g/mol |
| Exact Mass | 674.21 |
| IUPAC Name | 2-[1-[3-[4-[[5-[2-(2-fluoroanilino)-2-oxoethyl]-1,3-thiazol-2-yl]amino]-6-methoxyquinazolin-7-yl]oxypropyl]piperidin-2-yl]ethyl dihydrogen phosphate |
| SMILES | COc1cc2c(Nc3ncc(CC(=O)Nc4ccccc4F)s3)ncnc2cc1OCCCN1CCCCC1CCOP(=O)(O)O |
| InChI | InChI=1S/C30H36FN6O7PS/c1-42-26-16-22-25(17-27(26)43-13-6-12-37-11-5-4-7-20(37)10-14-44-45(39,40)41)33-19-34-29(22)36-30-32-18-21(46-30)15-28(38)35-24-9-3-2-8-23(24)31/h2-3,8-9,16-20H,4-7,10-15H2,1H3,(H,35,38)(H2,39,40,41)(H,32,33,34,36) |
| InChIKey | GGUQHKJQZQTDON-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 168.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.69 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|