C29H33F2N6O7PS — CID 91570903
[4-[4-[[5-[2-(3,4-difluoroanilino)-2-oxoethyl]-1,3-thiazol-2-yl]amino]-6-methoxyquinazolin-7-yl]oxy-1-piperidin-4-ylbutyl] dihydrogen phosphate (PubChem CID 91570903) has the molecular formula C29H33F2N6O7PS and a molecular weight of 678.66 g/mol. Its IUPAC name is [4-[4-[[5-[2-(3,4-difluoroanilino)-2-oxoethyl]-1,3-thiazol-2-yl]amino]-6-methoxyquinazolin-7-yl]oxy-1-piperidin-4-ylbutyl] dihydrogen phosphate.
| Compound Name | [4-[4-[[5-[2-(3,4-difluoroanilino)-2-oxoethyl]-1,3-thiazol-2-yl]amino]-6-methoxyquinazolin-7-yl]oxy-1-piperidin-4-ylbutyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 91570903 |
| Molecular Formula | C29H33F2N6O7PS |
| Molecular Weight | 678.66 g/mol |
| Exact Mass | 678.18 |
| IUPAC Name | [4-[4-[[5-[2-(3,4-difluoroanilino)-2-oxoethyl]-1,3-thiazol-2-yl]amino]-6-methoxyquinazolin-7-yl]oxy-1-piperidin-4-ylbutyl] dihydrogen phosphate |
| SMILES | COc1cc2c(Nc3ncc(CC(=O)Nc4ccc(F)c(F)c4)s3)ncnc2cc1OCCCC(OP(=O)(O)O)C1CCNCC1 |
| InChI | InChI=1S/C29H33F2N6O7PS/c1-42-25-13-20-23(14-26(25)43-10-2-3-24(44-45(39,40)41)17-6-8-32-9-7-17)34-16-35-28(20)37-29-33-15-19(46-29)12-27(38)36-18-4-5-21(30)22(31)11-18/h4-5,11,13-17,24,32H,2-3,6-10,12H2,1H3,(H,36,38)(H2,39,40,41)(H,33,34,35,37) |
| InChIKey | CKFWDBPWLGMDTG-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 177.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.66 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|