C20H25N5O3S — CID 58612604
2-[2-[(7-butoxy-6-methoxyquinazolin-4-yl)amino]-1,3-thiazol-5-yl]-N,N-dimethylacetamide (PubChem CID 58612604) has the molecular formula C20H25N5O3S and a molecular weight of 415.52 g/mol. Its IUPAC name is 2-[2-[(7-butoxy-6-methoxyquinazolin-4-yl)amino]-1,3-thiazol-5-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[2-[(7-butoxy-6-methoxyquinazolin-4-yl)amino]-1,3-thiazol-5-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 58612604 |
| Molecular Formula | C20H25N5O3S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 2-[2-[(7-butoxy-6-methoxyquinazolin-4-yl)amino]-1,3-thiazol-5-yl]-N,N-dimethylacetamide |
| SMILES | CCCCOc1cc2ncnc(Nc3ncc(CC(=O)N(C)C)s3)c2cc1OC |
| InChI | InChI=1S/C20H25N5O3S/c1-5-6-7-28-17-10-15-14(9-16(17)27-4)19(23-12-22-15)24-20-21-11-13(29-20)8-18(26)25(2)3/h9-12H,5-8H2,1-4H3,(H,21,22,23,24) |
| InChIKey | NVRXUKGTNHFWHI-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|