C28H38N8O3 — CID 154057718
3-[[(2,6-dimethylanilino)-[[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]amino]methylidene]amino]propanimidamide (PubChem CID 154057718) has the molecular formula C28H38N8O3 and a molecular weight of 534.67 g/mol. Its IUPAC name is 3-[[(2,6-dimethylanilino)-[[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]amino]methylidene]amino]propanimidamide.
| Compound Name | 3-[[(2,6-dimethylanilino)-[[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]amino]methylidene]amino]propanimidamide |
|---|---|
| PubChem CID | 154057718 |
| Molecular Formula | C28H38N8O3 |
| Molecular Weight | 534.67 g/mol |
| Exact Mass | 534.31 |
| IUPAC Name | 3-[[(2,6-dimethylanilino)-[[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]amino]methylidene]amino]propanimidamide |
| SMILES | [H]/N=C(\N)CC/N=C(/Nc1c(C)cccc1C)Nc1ncnc2cc(OCCCN3CCOCC3)c(OC)cc12 |
| InChI | InChI=1S/C28H38N8O3/c1-19-6-4-7-20(2)26(19)34-28(31-9-8-25(29)30)35-27-21-16-23(37-3)24(17-22(21)32-18-33-27)39-13-5-10-36-11-14-38-15-12-36/h4,6-7,16-18H,5,8-15H2,1-3H3,(H3,29,30)(H2,31,32,33,34,35) |
| InChIKey | NTOWSDRVXVFRDG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 143.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.67 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|