C24H29N5O2S — CID 22243890
1-(2,6-dimethylphenyl)-3-[6-methoxy-7-(2-pyrrolidin-1-ylethoxy)quinazolin-4-yl]thiourea (PubChem CID 22243890) has the molecular formula C24H29N5O2S and a molecular weight of 451.60 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-3-[6-methoxy-7-(2-pyrrolidin-1-ylethoxy)quinazolin-4-yl]thiourea.
| Compound Name | 1-(2,6-dimethylphenyl)-3-[6-methoxy-7-(2-pyrrolidin-1-ylethoxy)quinazolin-4-yl]thiourea |
|---|---|
| PubChem CID | 22243890 |
| Molecular Formula | C24H29N5O2S |
| Molecular Weight | 451.60 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-3-[6-methoxy-7-(2-pyrrolidin-1-ylethoxy)quinazolin-4-yl]thiourea |
| SMILES | COc1cc2c(NC(=S)Nc3c(C)cccc3C)ncnc2cc1OCCN1CCCC1 |
| InChI | InChI=1S/C24H29N5O2S/c1-16-7-6-8-17(2)22(16)27-24(32)28-23-18-13-20(30-3)21(14-19(18)25-15-26-23)31-12-11-29-9-4-5-10-29/h6-8,13-15H,4-5,9-12H2,1-3H3,(H2,25,26,27,28,32) |
| InChIKey | OMDJJRJKLZLZFR-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 71.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.60 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|