C23H27FN4O2 — CID 67314954
N-(2-fluoro-4-methylphenyl)-6-methoxy-7-(1-piperidin-4-ylethoxy)quinazolin-4-amine (PubChem CID 67314954) has the molecular formula C23H27FN4O2 and a molecular weight of 410.49 g/mol. Its IUPAC name is N-(2-fluoro-4-methylphenyl)-6-methoxy-7-(1-piperidin-4-ylethoxy)quinazolin-4-amine.
| Compound Name | N-(2-fluoro-4-methylphenyl)-6-methoxy-7-(1-piperidin-4-ylethoxy)quinazolin-4-amine |
|---|---|
| PubChem CID | 67314954 |
| Molecular Formula | C23H27FN4O2 |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | N-(2-fluoro-4-methylphenyl)-6-methoxy-7-(1-piperidin-4-ylethoxy)quinazolin-4-amine |
| SMILES | COc1cc2c(Nc3ccc(C)cc3F)ncnc2cc1OC(C)C1CCNCC1 |
| InChI | InChI=1S/C23H27FN4O2/c1-14-4-5-19(18(24)10-14)28-23-17-11-21(29-3)22(12-20(17)26-13-27-23)30-15(2)16-6-8-25-9-7-16/h4-5,10-13,15-16,25H,6-9H2,1-3H3,(H,26,27,28) |
| InChIKey | JOTAEHCILSZODU-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |